CAS 2925088-37-3 is the registry number for 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methyl-1H-indazole-7-carbaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carbaldehyde (CAS 2925088-37-3) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carbaldehyde. InChIKey: ALOYROLTJORNHU-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O3 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carbaldehyde |
| InChIKey | ALOYROLTJORNHU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(=N1)N3CCC(=O)NC3=O)C=O |
Computed by PubChem (NCBI)