Products 36995-93-4

CAS 36995-93-4 is the registry number for Lumiflavin 5-Oxide. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 5mg, 2mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

7,8,10-trimethyl-5-oxidobenzo[g]pteridin-5-ium-2,4-dione (CAS 36995-93-4) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 7,8,10-trimethyl-5-oxidobenzo[g]pteridin-5-ium-2,4-dione. InChIKey: NJIJZKAZUNYWDH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N4O3
Molecular weight272.26 g/mol
IUPAC name7,8,10-trimethyl-5-oxidobenzo[g]pteridin-5-ium-2,4-dione
InChIKeyNJIJZKAZUNYWDH-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)[N+](=C3C(=O)NC(=O)N=C3N2C)[O-]

Computed by PubChem (NCBI)