CAS 53558-25-1 is the registry number for Pyrinuron. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea (CAS 53558-25-1) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea. InChIKey: CLKZWXHKFXZIMA-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O3 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea |
| InChIKey | CLKZWXHKFXZIMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)