Products 72816-95-6

CAS 72816-95-6 is the registry number for N-Phenylmethyl-7-methyluric Acid. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

3-benzyl-7-methyl-9H-purine-2,6,8-trione (CAS 72816-95-6) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 3-benzyl-7-methyl-9H-purine-2,6,8-trione. InChIKey: LGRZSXBOIJJXNO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N4O3
Molecular weight272.26 g/mol
IUPAC name3-benzyl-7-methyl-9H-purine-2,6,8-trione
InChIKeyLGRZSXBOIJJXNO-UHFFFAOYSA-N
SMILESCN1C2=C(NC1=O)N(C(=O)NC2=O)CC3=CC=CC=C3

Computed by PubChem (NCBI)