CAS 72816-95-6 is the registry number for N-Phenylmethyl-7-methyluric Acid. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg.
3-benzyl-7-methyl-9H-purine-2,6,8-trione (CAS 72816-95-6) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 3-benzyl-7-methyl-9H-purine-2,6,8-trione. InChIKey: LGRZSXBOIJJXNO-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O3 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3-benzyl-7-methyl-9H-purine-2,6,8-trione |
| InChIKey | LGRZSXBOIJJXNO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC1=O)N(C(=O)NC2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)