Products 2925093-28-1
CAS 2925093-28-1 is the registry number for CRBN ligand-693. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-2-carbaldehyde (CAS 2925093-28-1) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: 4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-2-carbaldehyde. InChIKey: IPEKEXINZRMFCW-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-2-carbaldehyde |
| InChIKey | IPEKEXINZRMFCW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C=O)C(=CC=C2)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)