CAS 2925097-07-8 is the registry number for CRBN ligand-716. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-3-oxo-1H-isoindol-2-yl]acetic acid (CAS 2925097-07-8) is a chemical compound with the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. IUPAC name: 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-3-oxo-1H-isoindol-2-yl]acetic acid. InChIKey: KTLIKGDWIYDILX-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-3-oxo-1H-isoindol-2-yl]acetic acid |
| InChIKey | KTLIKGDWIYDILX-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)C(=O)N(C3)CC(=O)O |
Computed by PubChem (NCBI)