Products 2926651-43-4
CAS 2926651-43-4 appears in our catalog under these names: 1-(6-Chloropyridin-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 95%, 1-(6-Chloropyridin-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(6-chloro-3-pyridinyl)-1,3-diazinane-2,4-dione (CAS 2926651-43-4) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: 1-(6-chloro-3-pyridinyl)-1,3-diazinane-2,4-dione. InChIKey: VKWFNIWLQUUXQR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 1-(6-chloro-3-pyridinyl)-1,3-diazinane-2,4-dione |
| InChIKey | VKWFNIWLQUUXQR-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)