Products 2929239-84-7
CAS 2929239-84-7 is the registry number for LTB4 antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[methyl(2-phenylethyl)carbamoyl]-6-phenylmethoxy-1,4-benzodioxine-3-carboxylic acid (CAS 2929239-84-7) is a chemical compound with the molecular formula C26H23NO6 and a molecular weight of 445.5 g/mol. IUPAC name: 2-[methyl(2-phenylethyl)carbamoyl]-6-phenylmethoxy-1,4-benzodioxine-3-carboxylic acid. InChIKey: DFZGKPCZLKPNDK-UHFFFAOYSA-N.
| Molecular formula | C26H23NO6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | 2-[methyl(2-phenylethyl)carbamoyl]-6-phenylmethoxy-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | DFZGKPCZLKPNDK-UHFFFAOYSA-N |
| SMILES | CN(CCC1=CC=CC=C1)C(=O)C2=C(OC3=C(O2)C=CC(=C3)OCC4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)