Products 29308-82-5
CAS 29308-82-5 is the registry number for 8-Methyldibenzo[b,f][1,4]thiazepin-11(10H)-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-methyl-5H-benzo[b][1,4]benzothiazepin-6-one (CAS 29308-82-5) is a chemical compound with the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. IUPAC name: 3-methyl-5H-benzo[b][1,4]benzothiazepin-6-one. InChIKey: JNUXHEWGPQCJRD-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 3-methyl-5H-benzo[b][1,4]benzothiazepin-6-one |
| InChIKey | JNUXHEWGPQCJRD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)