CAS 29325-35-7 is the registry number for (3S,4R,5R,6S)-1,3,4,5,6,7-Hexahydroxyheptan-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R,5R,6S)-1,3,4,5,6,7-hexahydroxyheptan-2-one (CAS 29325-35-7) is a chemical compound with the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. IUPAC name: (3S,4R,5R,6S)-1,3,4,5,6,7-hexahydroxyheptan-2-one. InChIKey: HSNZZMHEPUFJNZ-UISOVIGQSA-N.
| Molecular formula | C7H14O7 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (3S,4R,5R,6S)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
| InChIKey | HSNZZMHEPUFJNZ-UISOVIGQSA-N |
| SMILES | C([C@@H]([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O)O |
Computed by PubChem (NCBI)