CAS 29329-99-5 is the registry number for 1,2-Diphenyl-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2-diphenylindole-3-carbaldehyde (CAS 29329-99-5) is a chemical compound with the molecular formula C21H15NO and a molecular weight of 297.3 g/mol. IUPAC name: 1,2-diphenylindole-3-carbaldehyde. InChIKey: VSWUURYDUFEIQQ-UHFFFAOYSA-N.
| Molecular formula | C21H15NO |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 1,2-diphenylindole-3-carbaldehyde |
| InChIKey | VSWUURYDUFEIQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2C4=CC=CC=C4)C=O |
Computed by PubChem (NCBI)