Products 573-34-2

CAS 573-34-2 is the registry number for 2,4,5-Triphenyloxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,4,5-triphenyl-1,3-oxazole (CAS 573-34-2) is a chemical compound with the molecular formula C21H15NO and a molecular weight of 297.3 g/mol. IUPAC name: 2,4,5-triphenyl-1,3-oxazole. InChIKey: WKHQADGJXFRQJD-UHFFFAOYSA-N.

Identity
Molecular formulaC21H15NO
Molecular weight297.3 g/mol
IUPAC name2,4,5-triphenyl-1,3-oxazole
InChIKeyWKHQADGJXFRQJD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(OC(=N2)C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)