CAS 573-34-2 is the registry number for 2,4,5-Triphenyloxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2,4,5-triphenyl-1,3-oxazole (CAS 573-34-2) is a chemical compound with the molecular formula C21H15NO and a molecular weight of 297.3 g/mol. IUPAC name: 2,4,5-triphenyl-1,3-oxazole. InChIKey: WKHQADGJXFRQJD-UHFFFAOYSA-N.
| Molecular formula | C21H15NO |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 2,4,5-triphenyl-1,3-oxazole |
| InChIKey | WKHQADGJXFRQJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)