CAS 852-37-9 is the registry number for 2-(4-Biphenyl)-5-phenyloxazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-phenyl-2-(4-phenylphenyl)-1,3-oxazole (CAS 852-37-9) is a chemical compound with the molecular formula C21H15NO and a molecular weight of 297.3 g/mol. IUPAC name: 5-phenyl-2-(4-phenylphenyl)-1,3-oxazole. InChIKey: RQGVWYIZAUHBBE-UHFFFAOYSA-N.
| Molecular formula | C21H15NO |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 5-phenyl-2-(4-phenylphenyl)-1,3-oxazole |
| InChIKey | RQGVWYIZAUHBBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC=C(O3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)