CAS 29334-13-2 is the registry number for 2,2,6,6–Tetramethylpiperidone–4–toluenesulfonate. Offered by: GLPBio. Available pack sizes: 500mg.
4-methylbenzenesulfonic acid;2,2,6,6-tetramethylpiperidin-4-one (CAS 29334-13-2) is a chemical compound with the molecular formula C16H25NO4S and a molecular weight of 327.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;2,2,6,6-tetramethylpiperidin-4-one. InChIKey: IYLPVORUFDDDFK-UHFFFAOYSA-N.
| Molecular formula | C16H25NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;2,2,6,6-tetramethylpiperidin-4-one |
| InChIKey | IYLPVORUFDDDFK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(CC(=O)CC(N1)(C)C)C |
Computed by PubChem (NCBI)