CAS 42495-21-6 is the registry number for 2,2,6,6-Tetramethyl-4-(4'-toluenesulfonate)piperidinooxyl. Offered by: TRC. Available pack sizes: 250mg.
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-methylbenzenesulfonate (CAS 42495-21-6) is a chemical compound with the molecular formula C16H25NO4S and a molecular weight of 327.4 g/mol. IUPAC name: (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-methylbenzenesulfonate. InChIKey: SRNPCPMNECAZKZ-UHFFFAOYSA-N.
| Molecular formula | C16H25NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 4-methylbenzenesulfonate |
| InChIKey | SRNPCPMNECAZKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC(N(C(C2)(C)C)O)(C)C |
Computed by PubChem (NCBI)