Products 2936672-07-8
CAS 2936672-07-8 is the registry number for (S)-2'-Oxo-5,6-dihydro-4H-spiro[benzo[d]isoxazole-7,1'-cyclohexane]-3-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-carbonitrile (CAS 2936672-07-8) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: (7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-carbonitrile. InChIKey: CAACZQWKICFEHN-CYBMUJFWSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-carbonitrile |
| InChIKey | CAACZQWKICFEHN-CYBMUJFWSA-N |
| SMILES | C1CC[C@@]2(CCCC3=C2ON=C3C#N)C(=O)C1 |
Computed by PubChem (NCBI)