CAS 2940-68-3 is the registry number for 3-(2-Chloroethyl)-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2-chloroethyl)quinazolin-4-one (CAS 2940-68-3) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 3-(2-chloroethyl)quinazolin-4-one. InChIKey: NJCVGJQMNUHBCF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-(2-chloroethyl)quinazolin-4-one |
| InChIKey | NJCVGJQMNUHBCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C=N2)CCCl |
Computed by PubChem (NCBI)