Products 2940857-54-3
CAS 2940857-54-3 is the registry number for tert-butyl (2S,5R)-5-hydroxy-2-(hydroxymethyl)-5-methyl-piperidine-1-carboxylate, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2S,5R)-5-hydroxy-2-(hydroxymethyl)-5-methylpiperidine-1-carboxylate (CAS 2940857-54-3) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (2S,5R)-5-hydroxy-2-(hydroxymethyl)-5-methylpiperidine-1-carboxylate. InChIKey: OHGSPRFDNOGLAW-JOYOIKCWSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (2S,5R)-5-hydroxy-2-(hydroxymethyl)-5-methylpiperidine-1-carboxylate |
| InChIKey | OHGSPRFDNOGLAW-JOYOIKCWSA-N |
| SMILES | C[C@]1(CC[C@H](N(C1)C(=O)OC(C)(C)C)CO)O |
Computed by PubChem (NCBI)