Products 2940857-94-1
CAS 2940857-94-1 is the registry number for ethyl (1S,2S)-2-amino-5,5-difluoro-cyclohexanecarboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride (CAS 2940857-94-1) is a chemical compound with the molecular formula C9H16ClF2NO2 and a molecular weight of 243.68 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride. InChIKey: WKDMKCSBYFWLGA-LEUCUCNGSA-N.
| Molecular formula | C9H16ClF2NO2 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | WKDMKCSBYFWLGA-LEUCUCNGSA-N |
| SMILES | CCOC(=O)[C@H]1CC(CC[C@@H]1N)(F)F.Cl |
Computed by PubChem (NCBI)