CAS 2940857-86-1 is the registry number for ethyl (1R,2R)-2-amino-5,5-difluoro-cyclohexanecarboxylate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Trans-ethyl (1R,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride (CAS 2940857-86-1) is a chemical compound with the molecular formula C9H16ClF2NO2 and a molecular weight of 243.68 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride. InChIKey: WKDMKCSBYFWLGA-ZJLYAJKPSA-N.
| Molecular formula | C9H16ClF2NO2 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | WKDMKCSBYFWLGA-ZJLYAJKPSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(CC[C@H]1N)(F)F.Cl |
Computed by PubChem (NCBI)