CAS 2306255-69-4 appears in our catalog under these names: (2R)-2-Amino-3-(4,4-difluorocyclohexyl)propanoic acid hydrochloride, 95%, (R)-2-Amino-3-(4,4-difluorocyclohexyl)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride (CAS 2306255-69-4) is a chemical compound with the molecular formula C9H16ClF2NO2 and a molecular weight of 243.68 g/mol. IUPAC name: (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride. InChIKey: MAJOAEKSMAWTQS-OGFXRTJISA-N.
| Molecular formula | C9H16ClF2NO2 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride |
| InChIKey | MAJOAEKSMAWTQS-OGFXRTJISA-N |
| SMILES | C1CC(CCC1C[C@H](C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)