CAS 887246-49-3 appears in our catalog under these names: Methyl (S)-2-amino-2-(4,4-difluorocyclohexyl)acetate hydrochloride, 98%, methyl (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetate,hydrochloride, 97%, 97%, METHYL (S)-2-AMINO-2-(4,4-DIFLUOROCYCLOHEXYL)ACETATE HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Methyl (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetate;hydrochloride (CAS 887246-49-3) is a chemical compound with the molecular formula C9H16ClF2NO2 and a molecular weight of 243.68 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetate;hydrochloride. InChIKey: PXWFSBDLLYXHPI-FJXQXJEOSA-N.
| Molecular formula | C9H16ClF2NO2 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4,4-difluorocyclohexyl)acetate;hydrochloride |
| InChIKey | PXWFSBDLLYXHPI-FJXQXJEOSA-N |
| SMILES | COC(=O)[C@H](C1CCC(CC1)(F)F)N.Cl |
Computed by PubChem (NCBI)