CAS 2306254-36-2 appears in our catalog under these names: (2S)-2-Amino-3-(4,4-difluorocyclohexyl)propanoic acid hydrochloride, 95%, (S)-2-Amino-3-(4,4-difluorocyclohexyl)propanoic acid hydrochloride, 97%, (S)–2–Amino–3–(4,4–difluorocyclohexyl)propanoic acid hydrochloride, (2S)-2-Amino-3-(4,4-difluorocyclohexyl)propanoic acid HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 50mg.
(2S)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride (CAS 2306254-36-2) is a chemical compound with the molecular formula C9H16ClF2NO2 and a molecular weight of 243.68 g/mol. IUPAC name: (2S)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride. InChIKey: MAJOAEKSMAWTQS-FJXQXJEOSA-N.
| Molecular formula | C9H16ClF2NO2 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | (2S)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride |
| InChIKey | MAJOAEKSMAWTQS-FJXQXJEOSA-N |
| SMILES | C1CC(CCC1C[C@@H](C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)