Products 2940859-05-0
CAS 2940859-05-0 is the registry number for (1R,4S)-2-azabicyclo[2.2.1]heptane,oxalic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1R,4S)-2-azabicyclo[2.2.1]heptane;oxalic acid (CAS 2940859-05-0) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: (1R,4S)-2-azabicyclo[2.2.1]heptane;oxalic acid. InChIKey: QNGZIDBJQMTRGN-RIHPBJNCSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (1R,4S)-2-azabicyclo[2.2.1]heptane;oxalic acid |
| InChIKey | QNGZIDBJQMTRGN-RIHPBJNCSA-N |
| SMILES | C1C[C@@H]2C[C@H]1CN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)