Products 2940875-97-6
CAS 2940875-97-6 is the registry number for (1R,3R)-3-(benzyloxycarbonylamino)-1-methyl-cyclopentanecarboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Cis-(1R,3R)-1-methyl-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 2940875-97-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1R,3R)-1-methyl-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: ZRHMRTBVOZMPOT-IUODEOHRSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1R,3R)-1-methyl-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | ZRHMRTBVOZMPOT-IUODEOHRSA-N |
| SMILES | C[C@]1(CC[C@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)