Products 2940879-27-4
CAS 2940879-27-4 is the registry number for tert-butyl (2S,5S)-2-ethyl-5-(hydroxymethyl)piperazine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl (2S,5S)-2-ethyl-5-(hydroxymethyl)piperazine-1-carboxylate (CAS 2940879-27-4) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl (2S,5S)-2-ethyl-5-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: RWGLBBDUIUCWNY-UWVGGRQHSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl (2S,5S)-2-ethyl-5-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | RWGLBBDUIUCWNY-UWVGGRQHSA-N |
| SMILES | CC[C@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)