CAS 2940880-01-1 is the registry number for tert-butyl (3S,6R)-3-{[(benzyloxy)carbonyl]amino}-6-hydroxyazepane-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R,6S)-3-hydroxy-6-(phenylmethoxycarbonylamino)azepane-1-carboxylate (CAS 2940880-01-1) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: tert-butyl (3R,6S)-3-hydroxy-6-(phenylmethoxycarbonylamino)azepane-1-carboxylate. InChIKey: WZWYUEFDQYWAAK-JKSUJKDBSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | tert-butyl (3R,6S)-3-hydroxy-6-(phenylmethoxycarbonylamino)azepane-1-carboxylate |
| InChIKey | WZWYUEFDQYWAAK-JKSUJKDBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC[C@H](C1)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)