Products 2940955-58-6

CAS 2940955-58-6 is the registry number for tert-butyl N-[2-(3-methoxyazetidin-3-yl)ethyl]carbamate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(3-methoxyazetidin-3-yl)ethyl]carbamate;hydrochloride (CAS 2940955-58-6) is a chemical compound with the molecular formula C11H23ClN2O3 and a molecular weight of 266.76 g/mol. IUPAC name: tert-butyl N-[2-(3-methoxyazetidin-3-yl)ethyl]carbamate;hydrochloride. InChIKey: JKHYWLAXWXMMSP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23ClN2O3
Molecular weight266.76 g/mol
IUPAC nametert-butyl N-[2-(3-methoxyazetidin-3-yl)ethyl]carbamate;hydrochloride
InChIKeyJKHYWLAXWXMMSP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC1(CNC1)OC.Cl

Computed by PubChem (NCBI)