Products 2940958-10-9
CAS 2940958-10-9 is the registry number for ethyl 6-bromo-4-methyl-1-oxo-2,3-dihydroisoquinoline-4-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 6-bromo-4-methyl-1-oxo-2,3-dihydroisoquinoline-4-carboxylate (CAS 2940958-10-9) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: ethyl 6-bromo-4-methyl-1-oxo-2,3-dihydroisoquinoline-4-carboxylate. InChIKey: GKXHSULHFOFQGZ-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | ethyl 6-bromo-4-methyl-1-oxo-2,3-dihydroisoquinoline-4-carboxylate |
| InChIKey | GKXHSULHFOFQGZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CNC(=O)C2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)