Products 2940958-59-6
CAS 2940958-59-6 is the registry number for 1-(2,2,2-trifluoro-1-methyl-ethyl)pyrazol-4-amine,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(1,1,1-trifluoropropan-2-yl)pyrazol-4-amine;hydrochloride (CAS 2940958-59-6) is a chemical compound with the molecular formula C6H9ClF3N3 and a molecular weight of 215.60 g/mol. IUPAC name: 1-(1,1,1-trifluoropropan-2-yl)pyrazol-4-amine;hydrochloride. InChIKey: NEEHADCLPQIOMY-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3 |
|---|---|
| Molecular weight | 215.60 g/mol |
| IUPAC name | 1-(1,1,1-trifluoropropan-2-yl)pyrazol-4-amine;hydrochloride |
| InChIKey | NEEHADCLPQIOMY-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)N1C=C(C=N1)N.Cl |
Computed by PubChem (NCBI)