Products 29413-65-8
CAS 29413-65-8 is the registry number for alpha,3,4-Trihydroxybenzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 50mg.
Methyl 2-(3,4-dihydroxyphenyl)-2-hydroxyacetate (CAS 29413-65-8) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: methyl 2-(3,4-dihydroxyphenyl)-2-hydroxyacetate. InChIKey: DXLNXATUNOYNFK-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl 2-(3,4-dihydroxyphenyl)-2-hydroxyacetate |
| InChIKey | DXLNXATUNOYNFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)O)O)O |
Computed by PubChem (NCBI)