CAS 29473-53-8 appears in our catalog under these names: N,N-Diethyl-N’-1-naphthylethylenediamine Oxalate, >95% (HPLC), N–(2–Diethylaminoethyl)–1–naphthylamine Oxalate, N1,N1-Diethyl-N2-1-naphthalenyl-1,2-ethanediamine ethanedioate, N-(2-Diethylaminoethyl)-1-naphthylamine Oxalate, >98.0%(T), N1,N1-Diethyl-N2-(naphthalen-1-yl)ethane-1,2-diamine oxalate, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 100mg, 1g, 25g, 5g, 250mg, 10g.
N',N'-diethyl-N-naphthalen-1-ylethane-1,2-diamine;oxalic acid (CAS 29473-53-8) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: N',N'-diethyl-N-naphthalen-1-ylethane-1,2-diamine;oxalic acid. InChIKey: MNUSPWMHIHYMKM-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | N',N'-diethyl-N-naphthalen-1-ylethane-1,2-diamine;oxalic acid |
| InChIKey | MNUSPWMHIHYMKM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC1=CC=CC2=CC=CC=C21.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)