Products 2947380-78-9

CAS 2947380-78-9 is the registry number for methyl (2R)-2-amino-3-tetrahydropyran-4-yl-propanoate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2R)-2-amino-3-(oxan-4-yl)propanoate;hydrochloride (CAS 2947380-78-9) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: methyl (2R)-2-amino-3-(oxan-4-yl)propanoate;hydrochloride. InChIKey: WCWXJCRWBPDXBR-DDWIOCJRSA-N.

Identity
Molecular formulaC9H18ClNO3
Molecular weight223.70 g/mol
IUPAC namemethyl (2R)-2-amino-3-(oxan-4-yl)propanoate;hydrochloride
InChIKeyWCWXJCRWBPDXBR-DDWIOCJRSA-N
SMILESCOC(=O)[C@@H](CC1CCOCC1)N.Cl

Computed by PubChem (NCBI)