CAS 2947393-64-6 appears in our catalog under these names: NNMT–IN–4, NNMT-IN-4, 99.35%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 25 mg, 50 mg, 5 mg, 10 mg.
(2R)-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (CAS 2947393-64-6) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: (2R)-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide. InChIKey: HLBSXLCCTVSVBK-RXMQYKEDSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (2R)-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| InChIKey | HLBSXLCCTVSVBK-RXMQYKEDSA-N |
| SMILES | C[C@@H]1CC2=C(N1)N=CC(=C2)C(=O)N |
Computed by PubChem (NCBI)