Products 2947427-76-9
CAS 2947427-76-9 is the registry number for 5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[2.3]hexane-5-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-(9H-fluoren-9-ylmethoxycarbonylamino)spiro[2.3]hexane-5-carboxylic acid (CAS 2947427-76-9) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)spiro[2.3]hexane-5-carboxylic acid. InChIKey: VDJONVRVTNEARC-UHFFFAOYSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 5-(9H-fluoren-9-ylmethoxycarbonylamino)spiro[2.3]hexane-5-carboxylic acid |
| InChIKey | VDJONVRVTNEARC-UHFFFAOYSA-N |
| SMILES | C1CC12CC(C2)(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)