Products 29477-55-2
CAS 29477-55-2 appears in our catalog under these names: Isoproterenol Impurity 1, 3,4-Dihydroxyphenylglyoxal. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-(3,4-dihydroxyphenyl)-2-oxoacetaldehyde (CAS 29477-55-2) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-2-oxoacetaldehyde. InChIKey: KAHDPCMFBOFNRC-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-2-oxoacetaldehyde |
| InChIKey | KAHDPCMFBOFNRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C=O)O)O |
Computed by PubChem (NCBI)