CAS 295357-66-3 appears in our catalog under these names: Lenalidomide Impurity 3, Lenalidomide Impurity 6, 2–(4–Amino–1–oxoisoindolin–2–yl)pentanedioic acid, 2-(4-Amino-1-oxoisoindolin-2-yl)pentanedioic acid, 2-(4-Amino-1-oxoisoindolin-2-yl)pentanedioic acid 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-(7-amino-3-oxo-1H-isoindol-2-yl)pentanedioic acid (CAS 295357-66-3) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: 2-(7-amino-3-oxo-1H-isoindol-2-yl)pentanedioic acid. InChIKey: DVFZIZCDDQITQV-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 2-(7-amino-3-oxo-1H-isoindol-2-yl)pentanedioic acid |
| InChIKey | DVFZIZCDDQITQV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2N)C(=O)N1C(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)