CAS 2955579-58-3 is the registry number for 2-methylindolin-7-amine,hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-2,3-dihydro-1H-indol-7-amine;hydrochloride (CAS 2955579-58-3) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 2-methyl-2,3-dihydro-1H-indol-7-amine;hydrochloride. InChIKey: OLGMHSLYISLUME-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 2-methyl-2,3-dihydro-1H-indol-7-amine;hydrochloride |
| InChIKey | OLGMHSLYISLUME-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(N1)C(=CC=C2)N.Cl |
Computed by PubChem (NCBI)