Products 2957210-11-4
CAS 2957210-11-4 is the registry number for CRBN ligand-194. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-amino-3-fluorophenyl)piperidine-2,6-dione (CAS 2957210-11-4) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: 3-(4-amino-3-fluorophenyl)piperidine-2,6-dione. InChIKey: VJHJPYASGBHJOX-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 3-(4-amino-3-fluorophenyl)piperidine-2,6-dione |
| InChIKey | VJHJPYASGBHJOX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)