CAS 29582-39-6 appears in our catalog under these names: trans–3–(4–Chlorobenzoyl)acrylic acid, (E)-4-(4-Chlorophenyl)-4-oxobut-2-enoic acid, 98%, 98%, 2-Butenoic acid, 4-(4-chlorophenyl)-4-oxo-, (2E)-, 96%, (E)-4-(4-Chlorophenyl)-4-oxobut-2-enoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g.
(E)-4-(4-chlorophenyl)-4-oxobut-2-enoic acid (CAS 29582-39-6) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: (E)-4-(4-chlorophenyl)-4-oxobut-2-enoic acid. InChIKey: VQVQEUFKSRHRCT-AATRIKPKSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | (E)-4-(4-chlorophenyl)-4-oxobut-2-enoic acid |
| InChIKey | VQVQEUFKSRHRCT-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)