Products 29587-82-4
CAS 29587-82-4 is the registry number for (E)-3-(4-Isopropylbenzoyl)acrylic acid. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g, 50g.
(E)-4-oxo-4-(4-propan-2-ylphenyl)but-2-enoic acid (CAS 29587-82-4) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: (E)-4-oxo-4-(4-propan-2-ylphenyl)but-2-enoic acid. InChIKey: RVKCMDZQHQJWAK-BQYQJAHWSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (E)-4-oxo-4-(4-propan-2-ylphenyl)but-2-enoic acid |
| InChIKey | RVKCMDZQHQJWAK-BQYQJAHWSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-Isopropylbenzoyl)acrylic acid, (E)-3-(4-Isopropylbenzoyl)acrylic acid, (2E)-4-oxo-4-[4-(propan-2-yl)phenyl]but-2-enoic acid, (E)-4-(4-Isopropylphenyl)-4-oxobut-2-enoic acid, (E)-4-oxo-4-(4-propan-2-ylphenyl)but-2-enoic acid, (E)-4-(4-isopropylphenyl)-4-oxo-but-2-enoic acid, (2E)-4-[4-(methylethyl)phenyl]-4-oxobut-2-enoic acid