CAS 2963597-44-4 is the registry number for GPR88 agonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-hydroxy-2-(4-pent-1-ynylphenyl)-N-[(1R)-1-phenylethyl]propanamide (CAS 2963597-44-4) is a chemical compound with the molecular formula C22H25NO2 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-3-hydroxy-2-(4-pent-1-ynylphenyl)-N-[(1R)-1-phenylethyl]propanamide. InChIKey: IICWJMCGHMSGMG-DYESRHJHSA-N.
| Molecular formula | C22H25NO2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-(4-pent-1-ynylphenyl)-N-[(1R)-1-phenylethyl]propanamide |
| InChIKey | IICWJMCGHMSGMG-DYESRHJHSA-N |
| SMILES | CCCC#CC1=CC=C(C=C1)[C@@H](CO)C(=O)N[C@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)