Products 2968508-62-3
CAS 2968508-62-3 is the registry number for 5-Bromo-1’-Boc-3H-spiro[isobenzofuran-1,4’-piperidin]-3-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-bromo-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate (CAS 2968508-62-3) is a chemical compound with the molecular formula C17H20BrNO4 and a molecular weight of 382.2 g/mol. IUPAC name: tert-butyl 5-bromo-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate. InChIKey: NAZVQKIPIRWORR-UHFFFAOYSA-N.
| Molecular formula | C17H20BrNO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carboxylate |
| InChIKey | NAZVQKIPIRWORR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=C(C=C3)Br)C(=O)O2 |
Computed by PubChem (NCBI)