Products 2971825-58-6

CAS 2971825-58-6 is the registry number for α2A-AR agonist 1, 99.92%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10mM/1mL, 25 mg, 10 mg, 50 mg.

Structural formula: {0} (CAS {1})

5-(8-bromo-3,4-dihydro-2H-chromen-4-yl)-1H-imidazole (CAS 2971825-58-6) is a chemical compound with the molecular formula C12H11BrN2O and a molecular weight of 279.13 g/mol. IUPAC name: 5-(8-bromo-3,4-dihydro-2H-chromen-4-yl)-1H-imidazole. InChIKey: CDYNCVBGLQHJIS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11BrN2O
Molecular weight279.13 g/mol
IUPAC name5-(8-bromo-3,4-dihydro-2H-chromen-4-yl)-1H-imidazole
InChIKeyCDYNCVBGLQHJIS-UHFFFAOYSA-N
SMILESC1COC2=C(C1C3=CN=CN3)C=CC=C2Br

Computed by PubChem (NCBI)