Products 2973762-96-6
CAS 2973762-96-6 is the registry number for 4-((tert-Butoxycarbonyl)amino)isoquinoline-6-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(2-methylpropan-2-yl)oxycarbonylamino]isoquinoline-6-carboxylic acid (CAS 2973762-96-6) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]isoquinoline-6-carboxylic acid. InChIKey: IJHRDTQNSVYBMU-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]isoquinoline-6-carboxylic acid |
| InChIKey | IJHRDTQNSVYBMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C2C=C(C=CC2=CN=C1)C(=O)O |
Computed by PubChem (NCBI)