Products 29765-49-9
CAS 29765-49-9 is the registry number for 1-{(4-(Trifluoromethoxy)phenyl)methyl}cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropane-1-carboxylic acid (CAS 29765-49-9) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: 1-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropane-1-carboxylic acid. InChIKey: FTWOJOXFIDZHRY-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | 1-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropane-1-carboxylic acid |
| InChIKey | FTWOJOXFIDZHRY-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)