CAS 2981430-43-5 is the registry number for ABA receptor agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]-3-methylbutanoic acid (CAS 2981430-43-5) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: (2R)-2-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]-3-methylbutanoic acid. InChIKey: IILLCPIJCURCHJ-LJQANCHMSA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (2R)-2-[[2-(4-cyano-3,5-dicyclopropylphenyl)acetyl]amino]-3-methylbutanoic acid |
| InChIKey | IILLCPIJCURCHJ-LJQANCHMSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NC(=O)CC1=CC(=C(C(=C1)C2CC2)C#N)C3CC3 |
Computed by PubChem (NCBI)