Products 2983462-55-9
CAS 2983462-55-9 is the registry number for Dexibuprofen 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 100mg.
3-hydroxybutan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (CAS 2983462-55-9) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: 3-hydroxybutan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: ALMMWNOSLRFGGB-HSBZDZAISA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 3-hydroxybutan-2-yl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | ALMMWNOSLRFGGB-HSBZDZAISA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)CC(C)C)C(=O)OC(C)C(C)O |
Computed by PubChem (NCBI)
Synonyms:
Dexibuprofen 2,3-Butylene Glycol Ester