Products 1219798-75-0
CAS 1219798-75-0 appears in our catalog under these names: (4-n-Nonylphenoxy)acetic-Alpha,Alpha-d2 Acid, >95% (HPLC), (4-n-Nonylphenoxy)acetic-a,a-d2 Acid, >95% (HPLC), (4-n-Nonylphenoxy)acetic-alpha,alpha-d2 Acid, 98 atom % D, min 98% Chemical Purity, 2-(4-Nonylphenoxy)acetic acid-d2, 99%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 25 mg, 5 mg, 10 mg.
2,2-dideuterio-2-(4-nonylphenoxy)acetic acid (CAS 1219798-75-0) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 280.4 g/mol. IUPAC name: 2,2-dideuterio-2-(4-nonylphenoxy)acetic acid. InChIKey: NISAHDHKGPWBEM-FNHLFAINSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 2,2-dideuterio-2-(4-nonylphenoxy)acetic acid |
| InChIKey | NISAHDHKGPWBEM-FNHLFAINSA-N |
| SMILES | [2H]C([2H])(C(=O)O)OC1=CC=C(C=C1)CCCCCCCCC |
Computed by PubChem (NCBI)