CAS 2988300-87-2 appears in our catalog under these names: Fmoc-L-Nva(3-Et-3-Me)-OH, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-ethyl-3-methylpentanoic acid, 95%, 95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-3-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid (CAS 2988300-87-2) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (2S)-3-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid. InChIKey: VCVVUHVVAJCPEZ-HXUWFJFHSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (2S)-3-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid |
| InChIKey | VCVVUHVVAJCPEZ-HXUWFJFHSA-N |
| SMILES | CCC(C)(CC)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)